
Catalog Number	AR00EBA2
Chemical Name	DL-TRYPTOPHAN-N-OCTYL ESTER HYDROCHLORIDE
CAS Number	6278-90-6
Molecular Formula	C19H29ClN2O2
Molecular Weight	352.8988
MDL Number	MFCD00050620
SMILES	CCCCCCCCOC(=O)C(Cc1c[nH]c2c1cccc2)N.Cl

Octyl 2-amino-3-(1H-indol-3-yl)propanoate hydrochloride is a versatile compound commonly utilized in chemical synthesis as a key building block in the creation of various pharmaceuticals, agrochemicals, and specialty chemicals. Its unique structure enables it to serve as a crucial intermediate in the production of complex organic molecules with a diverse range of applications. In chemical synthesis, this compound plays a crucial role as a precursor in the formation of intricate molecular structures, adding value to the development of novel compounds with tailored properties and functions. Its strategic incorporation in synthetic pathways offers chemists the opportunity to selectively modify and functionalize molecules, leading to the creation of new and innovative chemical entities.