
Catalog Number	AR00IBRR
Chemical Name	Benzamide, 2-methoxy-4-nitro-
CAS Number	62726-03-8
Molecular Formula	C8H8N2O4
Molecular Weight	196.1601
MDL Number	MFCD12913504
SMILES	COc1cc(ccc1C(=O)N)[N+](=O)[O-]

Benzamide, 2-methoxy-4-nitro- is a versatile compound commonly used in chemical synthesis as a building block for various organic molecules. This compound serves as an important intermediate in the production of pharmaceuticals, agrochemicals, and advanced materials due to its unique chemical reactivity and structural properties. With its precise combination of functional groups, Benzamide, 2-methoxy-4-nitro- offers significant potential for the creation of diverse and complex chemical structures through various synthetic pathways. In the realm of organic synthesis, this compound plays a crucial role in the development of novel compounds with potential applications across a wide range of industries.