
Catalog Number	AR00ERSJ
Chemical Name	4-(but-3-en-1-yloxycarbonyl)benzoic acid
CAS Number	62680-74-4
Molecular Formula	C12H12O4
Molecular Weight	220.2213
MDL Number	MFCD18976100
SMILES	C=CCCOC(=O)c1ccc(cc1)C(=O)O

The 4-((But-3-en-1-yloxy)carbonyl)benzoic acid is a versatile compound widely used in chemical synthesis due to its unique properties and functionalities. It serves as an important building block in the production of various organic compounds. In chemical synthesis, this compound can be utilized as a key intermediate for the preparation of various pharmaceuticals, agrochemicals, and other specialty chemicals. Its reactive carboxylic acid group allows for easy modification and derivatization, making it a valuable tool in the creation of novel molecules with tailored properties.Additionally, the presence of the but-3-en-1-yloxy moiety provides a handle for further organic transformations, enabling the introduction of additional functional groups or stereochemical control during synthesis processes. This feature enhances the versatility and applicability of 4-((But-3-en-1-yloxy)carbonyl)benzoic acid in diverse chemical reactions.Overall, this compound plays a crucial role in synthetic chemistry by serving as a valuable precursor for the construction of complex organic molecules with potential applications in various industries and research fields.