
Catalog Number	AR00EG06
Chemical Name	O-Desmethyl Metoprolol
CAS Number	62572-94-5
Molecular Formula	C14H23NO3
Molecular Weight	253.3373
MDL Number	MFCD01657298
SMILES	OCCc1ccc(cc1)OCC(CNC(C)C)O

1-(4-(2-Hydroxyethyl)phenoxy)-3-(isopropylamino)propan-2-ol is commonly utilized as a versatile building block in chemical synthesis due to its unique structural features. This compound serves as a key intermediate in the production of various pharmaceuticals, agrochemicals, and fine chemicals. Its hydroxyl and amino groups play a crucial role in reacting with other reagents to create complex molecular structures. In chemical synthesis, this compound can be employed to introduce functional groups, alter stereochemistry, and facilitate diverse transformations, making it an indispensable tool for organic chemists in the creation of novel molecules with potential biological activities.