
Catalog Number	AR00EBZ4
Chemical Name	2,3,5,6-TETRAFLUORONITROBENZENE
CAS Number	6257-03-0
Molecular Formula	C6HF4NO2
Molecular Weight	195.0713
MDL Number	MFCD02093333
SMILES	Fc1cc(F)c(c(c1F)[N+](=O)[O-])F

2,3,5,6-Tetrafluoronitrobenzene is a versatile chemical compound that finds wide application in chemical synthesis processes. As a highly reactive and fluorinated derivative of nitrobenzene, this compound is valued for its unique properties and capabilities in organic chemistry.In chemical synthesis, 2,3,5,6-Tetrafluoronitrobenzene serves as a valuable building block for the creation of various complex molecules. Its ability to undergo diverse reactions, such as nucleophilic aromatic substitution, allows it to be utilized in the preparation of pharmaceuticals, agrochemicals, and advanced materials.Furthermore, the presence of multiple fluorine atoms in 2,3,5,6-Tetrafluoronitrobenzene enhances its reactivity and influences the physical and chemical properties of the resulting products. This compound can be employed as a fluorine source in the introduction of fluorinated moieties into organic molecules, which is of great interest in medicinal chemistry and materials science.Overall, the strategic incorporation of 2,3,5,6-Tetrafluoronitrobenzene in chemical synthesis enables the efficient construction of complex molecular structures with desired fluorinated functionalities, making it a valuable tool for researchers and chemists in various fields of science and industry.