
Catalog Number	AR00EM42
Chemical Name	N-(4-Fluorobenzoyl)-L-proline
CAS Number	62522-93-4
Molecular Formula	C12H12FNO3
Molecular Weight	237.2270
MDL Number	MFCD09757450
SMILES	OC(=O)[C@@H]1CCCN1C(=O)c1ccc(cc1)F

The (S)-1-(4-Fluorobenzoyl)pyrrolidine-2-carboxylic acid is a versatile compound widely used in chemical synthesis due to its unique properties and reactivity. In organic synthesis, it serves as a key building block for creating various pharmaceuticals, agrochemicals, and functional materials. The chiral nature of this compound plays a crucial role in asymmetric synthesis, enabling the creation of enantiomerically pure products with high yields and selectivity. Additionally, (S)-1-(4-Fluorobenzoyl)pyrrolidine-2-carboxylic acid is utilized as a catalyst in several reactions, facilitating complex transformations and improving reaction efficiency. Its application extends to the development of novel drug candidates, advanced materials, and fine chemicals, showcasing its significance in modern chemical research and development.