
Catalog Number	AR00EKJ4
Chemical Name	7-METHOXYQUINAZOLINE-2,4(1H,3H)-DIONE
CAS Number	62484-12-2
Molecular Formula	C9H8N2O3
Molecular Weight	192.1714
MDL Number	MFCD09954839
SMILES	COc1ccc2c(c1)[nH]c(=O)[nH]c2=O

7-Methoxyquinazoline-2,4-diol is a versatile compound that finds wide application in chemical synthesis. This unique molecule serves as a valuable building block in the creation of various pharmaceuticals, agrochemicals, and organic materials.Its functional groups and structural characteristics make it a valuable intermediate in the synthesis of bioactive compounds, such as kinase inhibitors and antiviral agents. Its presence in the molecular structure imparts desired properties and enhances the biological activity of the final products.In organic synthesis, 7-Methoxyquinazoline-2,4-diol serves as a key synthon for the construction of complex molecules through various synthetic methodologies like coupling reactions, cyclizations, and oxidative transformations. Its reactivity and compatibility with a wide range of functional groups make it a favored choice for medicinal chemists and organic chemists alike.Overall, the strategic incorporation of 7-Methoxyquinazoline-2,4-diol in chemical synthesis enables the efficient and precise construction of diverse molecular architectures with potential applications in pharmaceuticals, agrochemicals, and material science.