
Catalog Number	AR00EDJ6
Chemical Name	4-BROMO-4'-NITROBIPHENYL
CAS Number	6242-98-4
Molecular Formula	C12H8BrNO2
Molecular Weight	278.1014
MDL Number	MFCD00024697
SMILES	Brc1ccc(cc1)c1ccc(cc1)[N+](=O)[O-]
NSC Number	32424

4-Bromo-4'-nitro-1,1'-biphenyl is a versatile compound commonly used in chemical synthesis as a building block for various organic molecules. Due to its unique structure and reactivity, this compound plays a crucial role in the design and synthesis of pharmaceuticals, agrochemicals, and materials. In organic synthesis, it serves as a key intermediate in the preparation of complex organic compounds with diverse biological and physical properties. Its functional groups allow for selective modifications and functionalizations, making it valuable for creating intricate molecular structures and achieving specific chemical transformations. Additionally, 4-Bromo-4'-nitro-1,1'-biphenyl's presence in a molecule can confer specific properties or activities, enhancing the overall performance or functionality of the final product. Its strategic incorporation in chemical synthesis enables the development of new compounds with tailored properties and applications in various fields of science and industry.