
Catalog Number	AR003OMD
Chemical Name	ARSENAZO III DISODIUM SALT
CAS Number	62337-00-2
Molecular Formula	C22H18As2N4NaO14S2
Molecular Weight	799.3597
MDL Number	MFCD00003936
SMILES	Oc1c2c(cc(c1N=Nc1ccccc1[As](=O)(O)O)S(=O)(=O)O)cc(c(c2O)N=Nc1ccccc1[As](=O)(O)O)S(=O)(=O)O.[Na]

The disodium salt of Arsenazo III is frequently used in chemical synthesis as a selective reagent for the detection and determination of various metal ions, particularly for the quantification of arsenic. It exhibits a high sensitivity towards the presence of metal ions, making it a valuable tool in analytical chemistry. Arsenazo III disodium salt is employed in spectrophotometric methods to measure metal concentrations in solutions, aiding in the identification and analysis of trace amounts of metals in various samples. Its ability to form stable complexes with metal ions allows for precise measurements and reliable results in chemical synthesis processes.