
Catalog Number	AR00EJXH
Chemical Name	4-[(4-chlorobenzyl)oxy]benzoic acid
CAS Number	62290-40-8
Molecular Formula	C14H11ClO3
Molecular Weight	262.6883
MDL Number	MFCD04521327
SMILES	Clc1ccc(cc1)COc1ccc(cc1)C(=O)O

With its unique molecular structure, 4-((4-Chlorobenzyl)oxy)benzoic acid serves as a versatile building block in chemical synthesis. This compound is widely utilized in organic chemistry for the preparation of various derivatives and complex molecules. Its functional groups enable it to participate in a diverse range of reactions, making it a valuable tool in the creation of new compounds. From the formation of ester linkages to the synthesis of pharmaceutical intermediates, 4-((4-Chlorobenzyl)oxy)benzoic acid plays a crucial role in the development of novel materials and compounds. Its versatility and reactivity make it a key component in the toolbox of synthetic chemists seeking to engineer intricate molecular structures with specific properties.