
Catalog Number	AR00EQ3E
Chemical Name	(1β,3α,5β)-Bicyclo[3.3.1]nonane-3-carboxylic acid
CAS Number	6221-62-1
Molecular Formula	C10H16O2
Molecular Weight	168.2328
MDL Number	MFCD11100967
SMILES	OC(=O)[C@@H]1CC2CCCC(C1)C2

Bicyclo[3.3.1]nonane-3-carboxylic acid is a versatile building block commonly utilized in chemical synthesis due to its unique structural properties. This compound is valued for its ability to incorporate into complex molecular frameworks, allowing for the synthesis of various organic molecules with desired stereochemical arrangements. In particular, the strained ring system of bicyclo[3.3.1]nonane-3-carboxylic acid can serve as a rigid scaffold, influencing the spatial orientation of functional groups during chemical reactions. This characteristic makes it a valuable reagent in the construction of intricate molecular architectures and the development of new pharmaceuticals, agrochemicals, and materials. Additionally, the presence of a carboxylic acid group in this compound enables facile derivatization, further expanding its utility in synthetic applications, such as in the preparation of bioactive compounds and natural product analogs.