
Catalog Number	AR00E9MV
Chemical Name	Cbz-L-Valinol
CAS Number	6216-65-5
Molecular Formula	C13H19NO3
Molecular Weight	237.2949
MDL Number	MFCD00672539
SMILES	OC[C@H](C(C)C)NC(=O)OCc1ccccc1

Cbz-L-Valinol, also known as N-carbobenzyloxy-L-valinol, is a chiral auxiliary widely used in chemical synthesis for the asymmetric induction of stereochemistry. This compound is particularly valued in organic chemistry for its ability to control the stereochemistry of reactions, enabling the enantioselective synthesis of various compounds.In chemical synthesis, Cbz-L-Valinol serves as a valuable tool in the creation of complex molecules with defined stereochemistry. It is often employed in asymmetric synthesis strategies where precise control over chiral centers is essential. By attaching to a substrate, Cbz-L-Valinol can influence the pathway of a reaction, leading to the formation of chiral products with high enantiomeric purity.One of the key applications of Cbz-L-Valinol is in the preparation of enantiomerically enriched compounds such as pharmaceutical intermediates, natural products, and fine chemicals. Its versatile nature allows chemists to access a wide range of enantiomerically pure molecules that are crucial in drug discovery, materials science, and other fields where stereochemical control is paramount.Overall, Cbz-L-Valinol plays a vital role in modern organic synthesis by enabling chemists to access chiral compounds with high selectivity and efficiency, making it an indispensable tool for achieving stereochemical precision in chemical reactions.