
Catalog Number	AR00ECI4
Chemical Name	4-(4-Chloro-phenyl)-3-oxo-butyric acid ethyl ester
CAS Number	62088-10-2
Molecular Formula	C12H13ClO3
Molecular Weight	240.6828
MDL Number	MFCD03844412
SMILES	CCOC(=O)CC(=O)Cc1ccc(cc1)Cl

The Benzenebutanoic acid, 4-chloro-β-oxo-, ethyl ester is a versatile compound commonly utilized in chemical synthesis. This compound serves as a key building block in the creation of various pharmaceutical, agrochemical, and advanced materials. Its unique chemical structure enables it to participate in a wide range of reactions, making it a valuable intermediate in the production of numerous organic compounds.In chemical synthesis, Benzenebutanoic acid, 4-chloro-β-oxo-, ethyl ester is commonly employed in the formation of more complex molecules through processes such as esterification, acylation, and nucleophilic substitution. Its reactivity and compatibility with a variety of functional groups make it a valuable tool for chemists seeking to diversify their synthetic routes and access novel compounds.Overall, the Benzenebutanoic acid, 4-chloro-β-oxo-, ethyl ester plays a crucial role in the field of chemical synthesis, offering chemists the opportunity to explore new synthetic pathways and expand the scope of organic chemistry.