
Catalog Number	AR00EDX2
Chemical Name	2-(P-NITROBENZYL)PYRIDINE
CAS Number	620-87-1
Molecular Formula	C12H10N2O2
Molecular Weight	214.22
MDL Number	MFCD00043592
SMILES	[O-][N+](=O)c1ccc(cc1)Cc1ccccn1
NSC Number	31608

2-(4-nitrobenzyl)pyridine is a versatile compound commonly used in chemical synthesis as a key building block for various organic reactions. This compound serves as a valuable substrate in the production of diverse pharmaceuticals, agrochemicals, and functional materials due to its unique chemical properties. Its nitro group can be selectively reduced to an amine group, allowing for further derivatization and modification to obtain a wide range of target molecules. Additionally, the pyridine ring in 2-(4-nitrobenzyl)pyridine provides reactivity and functional diversity, making it a valuable intermediate in the synthesis of complex organic compounds. This compound is particularly useful in the preparation of heterocyclic compounds and plays a significant role in the development of innovative chemicals with potential applications in various industries.