
Catalog Number	AR003T9P
Chemical Name	N,N-DIMETHYL-3-NITROANILINE
CAS Number	619-31-8
Molecular Formula	C8H10N2O2
Molecular Weight	166.1772
MDL Number	MFCD00007236
SMILES	CN(c1cccc(c1)[N+](=O)[O-])C
NSC Number	9814

N,N-Dimethyl-3-nitroaniline is a valuable compound widely used in chemical synthesis, particularly in the production of dyes, pharmaceuticals, and agrochemicals. This versatile chemical building block is essential for creating various organic compounds through simple synthetic routes and modifications. Its unique molecular structure provides opportunities for creating a wide range of functional materials, including specialty dyes with vibrant colors, biologically active pharmaceutical ingredients, and effective crop protection agents. In chemical synthesis, N,N-Dimethyl-3-nitroaniline serves as a key intermediate in the preparation of complex molecules, contributing significantly to the development of innovative products across different industries.