
Catalog Number	AR00EVUY
Chemical Name	2,5-Dinitrotoluene
CAS Number	619-15-8
Molecular Formula	C7H6N2O4
Molecular Weight	182.13354
MDL Number	MFCD00047688
SMILES	[O-][N+](=O)c1ccc(c(c1)C)[N+](=O)[O-]
NSC Number	159120
UN Number	3454

Benzene, 2-methyl-1,4-dinitro- is a key compound widely utilized in chemical synthesis for its versatile applications. This compound serves as a crucial building block in the production of various organic compounds due to its unique properties.In chemical synthesis, Benzene, 2-methyl-1,4-dinitro- is frequently used as a precursor in the creation of other complex molecules. Its structure allows for the introduction of different functional groups, enabling chemists to tailor its reactivity for specific reactions. The nitro groups present on the benzene ring provide opportunities for further derivatization, making it a valuable intermediate in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals.Moreover, Benzene, 2-methyl-1,4-dinitro- plays a critical role in the development of new materials and compounds with specific properties. By incorporating this compound into chemical reactions, researchers can access a diverse range of products with varied functionalities, paving the way for innovative discoveries in the field of chemistry.Overall, Benzene, 2-methyl-1,4-dinitro- is a versatile compound essential for chemical synthesis, offering unparalleled opportunities for designing and creating novel molecules with tailored properties and applications.