
Catalog Number	AR01DN3C
Chemical Name	CIS-1-AMINO-4-TERT-BUTYLCYCLOHEXANE
CAS Number	61886-14-4
Molecular Formula	C10H22ClN
Molecular Weight	191.7414
MDL Number	MFCD25371559
SMILES	N[C@@H]1CC[C@@H](CC1)C(C)(C)C.Cl

Cyclohexanamine, 4-(1,1-dimethylethyl)-, hydrochloride, cis- (9CI) is a versatile chemical compound commonly used in chemical synthesis processes. This specific form of cyclohexanamine hydrochloride is known for its cis configuration, which is important for controlling stereochemistry in reactions. In chemical synthesis, this compound can be utilized as a reagent in various transformations such as alkylations, acylations, and condensation reactions. Its hydrochloride salt form provides increased stability and solubility in aqueous environments, making it particularly useful in reactions where water is present. Additionally, the bulky tert-butyl group attached to the amine moiety can influence the steric effects in reactions, leading to selective product formation. Overall, Cyclohexanamine, 4-(1,1-dimethylethyl)-, hydrochloride, cis- (9CI) plays a crucial role in the efficient and controlled synthesis of organic compounds in chemical research and development.