
Catalog Number	AR00ILRO
Chemical Name	rel-(1R,3S)-Methyl 3-hydroxycyclohexanecarboxylate
CAS Number	6183-54-6
Molecular Formula	C8H14O3
Molecular Weight	158.19496
MDL Number	MFCD27926393
SMILES	COC(=O)[C@@H]1CCC[C@@H](C1)O

The methyl (1R,3S)-rel-3-hydroxycyclohexane-1-carboxylate is a versatile compound commonly used in chemical synthesis due to its unique stereochemical properties. In organic synthesis, this compound serves as a valuable building block for creating complex molecules with specific stereochemistry. Its presence allows chemists to easily access chiral intermediates, which are crucial in the synthesis of pharmaceuticals, natural products, and other fine chemicals. By incorporating this compound into a synthetic route, chemists can efficiently produce target molecules with high stereoselectivity, ultimately leading to more efficient and cost-effective synthesis processes.