
Catalog Number	AR00EHU3
Chemical Name	5-(TRIFLUOROMETHYL)-1-(2-METHOXYPHENYL)-1H-PYRAZOLE-4-CARBOXYLIC ACID
CAS Number	618070-64-7
Molecular Formula	C12H9F3N2O3
Molecular Weight	286.2067
MDL Number	MFCD03934810
SMILES	COc1ccccc1n1ncc(c1C(F)(F)F)C(=O)O

1-(2-Methoxyphenyl)-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid is a powerful tool in chemical synthesis due to its unique structure and reactivity. This compound is commonly used as a building block for the synthesis of various pharmaceuticals, agrochemicals, and specialty chemicals. Its trifluoromethyl group enhances the compound's stability, solubility, and lipophilicity, making it a valuable moiety in drug design and discovery. Additionally, the presence of a pyrazole ring in the molecule offers the potential for diverse interactions and biological activities in the synthesized products. Overall, this compound serves as a versatile intermediate in organic synthesis, enabling the efficient construction of complex molecular architectures with promising applications in various industries.