
Catalog Number	AR00EG7S
Chemical Name	1-(4-BROMOPHENYL)-5-(TRIFLUOROMETHYL)-1H-PYRAZOLE-4-CARBOXYLIC ACID
CAS Number	618070-63-6
Molecular Formula	C11H6BrF3N2O2
Molecular Weight	335.0767
MDL Number	MFCD03934808
SMILES	Brc1ccc(cc1)n1ncc(c1C(F)(F)F)C(=O)O

1-(4-Bromophenyl)-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid, also known as $name$, is a versatile compound widely used in chemical synthesis due to its unique properties and reactivity. This compound serves as a key building block in the preparation of various organic molecules and pharmaceuticals.In chemical synthesis, $name$ plays a crucial role as a precursor in the creation of heterocyclic compounds through cyclization reactions. Its presence enables the formation of complex structures with desired pharmacological activities. Furthermore, the trifluoromethyl group attached to the pyrazole ring imparts distinctive properties to the final products, enhancing their bioavailability and metabolic stability.Additionally, $name$ can be utilized in the synthesis of fluorinated analogs of existing drug molecules, amplifying their potency and specificity. The bromophenyl moiety in the structure opens avenues for further functionalization, allowing for the introduction of additional groups to tailor the compound for specific applications.Overall, the strategic incorporation of 1-(4-Bromophenyl)-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid in chemical synthesis processes enables the construction of diverse molecular scaffolds with the potential for pharmaceutical development and material science advancements. This compound exemplifies its significance as a versatile building block in the realm of organic chemistry.