
Catalog Number	AR00IBLU
Chemical Name	3-Quinolinecarboxylic acid, 1,4-dihydro-4-oxo-, methyl ester
CAS Number	61707-79-7
Molecular Formula	C11H9NO3
Molecular Weight	203.1941
MDL Number	MFCD01244470
SMILES	COC(=O)c1c[nH]c2c(c1=O)cccc2

Methyl 4-oxo-1,4-dihydroquinoline-3-carboxylate is a versatile compound commonly used in chemical synthesis. Its unique structure and reactivity make it a valuable building block in the creation of various organic molecules.In chemical synthesis, this compound is often employed as a key intermediate in the preparation of heterocyclic compounds. Due to its conjugated system and potential for cyclization reactions, Methyl 4-oxo-1,4-dihydroquinoline-3-carboxylate serves as a valuable starting material for the synthesis of complex compounds with important biological activities.Additionally, this compound can participate in a range of functional group transformations, including acylation, alkylation, and reduction reactions. Its presence as a functional group can impart specific properties to the final molecule, making it a valuable tool in the design and synthesis of new chemical entities.Overall, Methyl 4-oxo-1,4-dihydroquinoline-3-carboxylate plays a crucial role in the strategic planning and execution of chemical syntheses, enabling the efficient construction of diverse organic molecules with potential applications in medicinal chemistry, materials science, and beyond.