
Catalog Number	AR019FP3
Chemical Name	Cis-Tert-Butyl 2-Allyl-3-Hydroxypiperidine-1-Carboxylate
CAS Number	616890-33-6
Molecular Formula	C13H23NO3
Molecular Weight	241.3266
MDL Number	MFCD30471970
SMILES	C=CC[C@@H]1[C@H](O)CCCN1C(=O)OC(C)(C)C

The Cis-Tert-Butyl 2-Allyl-3-Hydroxypiperidine-1-Carboxylate is a versatile compound commonly used in chemical synthesis processes. It serves as a key building block in various organic reactions due to its unique structure and reactivity. In the realm of organic chemistry, this compound is often utilized as a precursor for the synthesis of complex molecules and pharmaceutical intermediates. Its ability to undergo selective functional group transformations makes it a valuable tool for achieving specific structural modifications in target molecules. Additionally, the Cis-Tert-Butyl 2-Allyl-3-Hydroxypiperidine-1-Carboxylate plays a crucial role in the development of new synthetic routes and methodologies, offering chemists a strategic advantage in designing efficient synthetic routes for the production of diverse chemical compounds.