
Catalog Number	AR00ELX7
Chemical Name	4-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)aniline hydrochloride
CAS Number	616227-14-6
Molecular Formula	C12H19BClNO2
Molecular Weight	255.5488
MDL Number	MFCD02258965
SMILES	CC1(C)OB(OC1(C)C)c1ccc(cc1)N.Cl

4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)aniline hydrochloride is a versatile compound often utilized in chemical synthesis for its unique properties. This compound serves as a valuable building block in organic synthesis, particularly in the formation of carbon-carbon and carbon-heteroatom bonds. Due to its boron-containing structure, it acts as a boron source in various cross-coupling reactions, such as Suzuki-Miyaura, Chan-Lam, and Stille coupling reactions.Additionally, 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)aniline hydrochloride is commonly used in pharmaceutical research and agrochemical development to introduce specific functionalities into target molecules. Its hydrochloride salt form enhances solubility in polar solvents, making it easier to handle in reactions. Overall, this compound plays a vital role in the construction of complex organic molecules with tailored properties for diverse applications in the field of chemistry.