
Catalog Number	AR00E9MR
Chemical Name	1-(4-Nitrophenyl)-1,2-propanedione
CAS Number	6159-25-7
Molecular Formula	C9H7NO4
Molecular Weight	193.1562
MDL Number	MFCD01882876
SMILES	CC(=O)C(=O)c1ccc(cc1)[N+](=O)[O-]
NSC Number	65586

1-(4-Nitrophenyl)propane-1,2-dione, also known as $name$, plays a crucial role in various chemical synthesis processes. Paired with its unique molecular structure, this compound serves as a versatile building block in organic chemistry. Its application in chemical synthesis extends to the creation of pharmaceuticals, agrochemicals, and specialty chemicals due to its multiple reaction sites that enable diverse transformations. Furthermore, $name$ facilitates the formation of intricate molecular structures through its involvement in key synthetic pathways, making it a valuable asset in the hands of synthetic chemists.