
Catalog Number	AR00EC8X
Chemical Name	2-(4-Amino-2-chloro-5-methylphenyl)-2-(4-chlorophenyl)acetonitrile
CAS Number	61437-85-2
Molecular Formula	C15H12Cl2N2
Molecular Weight	291.1752
MDL Number	MFCD00044794
SMILES	N#CC(c1cc(C)c(cc1Cl)N)c1ccc(cc1)Cl

2-(4-Amino-2-chloro-5-methylphenyl)-2-(4-chlorophenyl)acetonitrile, often simply referred to as $name$, is a versatile compound widely used in chemical synthesis. Its primary application lies in its ability to serve as a key building block in the creation of complex organic molecules. One common usage of $name$ is as a precursor in the synthesis of pharmaceutical compounds. By incorporating this molecule into a synthetic pathway, chemists can introduce specific functional groups and structural motifs that are essential for the desired biological activity of the final drug product. This compound's unique structure, with its dual aromatic rings and cyano group, provides opportunities for diverse chemical transformations leading to a variety of potential bioactive molecules.Furthermore, $name$ can be employed in the preparation of agrochemicals, dyes, and materials science applications. Its presence in a molecule can enhance stability, solubility, or reactivity, depending on the desired characteristics of the final product. The versatility of this compound makes it a valuable tool for chemists working in various fields of research and development.In summary, 2-(4-Amino-2-chloro-5-methylphenyl)-2-(4-chlorophenyl)acetonitrile plays a crucial role in chemical synthesis, offering a wide range of opportunities for the construction of diverse organic compounds with tailored properties and functionalities.