
Catalog Number	AR00IBJN
Chemical Name	Cyclohexaneacetic acid, a-amino-, hydrochloride, (R)-
CAS Number	61367-40-6
Molecular Formula	C8H16ClNO2
Molecular Weight	193.6711
MDL Number	MFCD00067543
SMILES	N[C@@H](C(=O)O)C1CCCCC1.Cl

H-D-Chg-OH.HCl is a versatile compound commonly used in chemical synthesis for a variety of applications. Its unique properties make it a valuable tool for organic chemists seeking to create complex molecules through strategic chemical transformations. One of its key functions lies in its ability to selectively introduce anhydrous conditions during chemical reactions, facilitating precise control over reaction pathways and product formation. This compound is particularly useful in the synthesis of pharmaceuticals, natural products, and advanced materials where controlling reaction selectivity is crucial. In addition, H-D-Chg-OH.HCl can serve as a protecting group for sensitive functional groups, shielding them from undesired reactions until they are needed for subsequent steps. Its compatibility with a wide range of functional groups and reaction conditions makes it a valuable asset in the toolkit of synthetic chemists striving to design efficient and tailored synthetic routes.