
Catalog Number	AR00EAR5
Chemical Name	ETHYL 3-(4-HYDROXY-3-METHOXYPHENYL)PROPIONATE
CAS Number	61292-90-8
Molecular Formula	C12H16O4
Molecular Weight	224.253
MDL Number	MFCD00017278
SMILES	CCOC(=O)CCc1ccc(c(c1)OC)O

Ethyl 3-(4-hydroxy-3-methoxyphenyl)propanoate is a versatile compound used in chemical synthesis for its ability to serve as a building block in the creation of various organic compounds. This compound can be utilized in the synthesis of pharmaceuticals, flavoring agents, and fragrances due to its unique chemical structure and reactivity. Its presence in the synthesis process can contribute to the development of new and innovative chemical products with desirable properties. By incorporating Ethyl 3-(4-hydroxy-3-methoxyphenyl)propanoate into a synthesis pathway, chemists can efficiently access complex molecules with tailored functionalities for a wide range of applications.