
Catalog Number	AR00EEUU
Chemical Name	Piperazine, 1-[4-(methylsulfonyl)-2-nitrophenyl]- (9CI)
CAS Number	610275-77-9
Molecular Formula	C11H15N3O4S
Molecular Weight	285.3195
MDL Number	MFCD03407994
SMILES	[O-][N+](=O)c1cc(ccc1N1CCNCC1)S(=O)(=O)C

1-[4-(methylsulfonyl)-2-nitrophenyl]piperazine is a versatile compound commonly used in chemical synthesis as a key building block for the creation of various pharmaceuticals and agrochemicals. Due to its unique structure, this compound serves as a valuable intermediate in the production of complex molecules with therapeutic and agricultural applications. By incorporating 1-[4-(methylsulfonyl)-2-nitrophenyl]piperazine into the synthesis process, chemists are able to introduce specific functional groups and enhance the biological activity of the final products. This compound plays a crucial role in the development of new drugs and crop protection chemicals, highlighting its significance in the field of organic synthesis.