
Catalog Number	AR00IBGL
Chemical Name	L-Threonine, O-(phenylmethyl)-, hydrochloride
CAS Number	60856-51-1
Molecular Formula	C11H16ClNO3
Molecular Weight	245.7026
MDL Number	MFCD00235875
SMILES	C[C@H]([C@@H](C(=O)O)N)OCc1ccccc1.Cl

H-Thr(Bzl)-OH·HCl is a valuable reagent commonly used in chemical synthesis for the selective protection of the hydroxyl group in amino acids. This compound plays a crucial role in peptide and protein synthesis by providing a safeguard for the hydroxyl functional group, thereby allowing specific reactions to occur without undesired side reactions. With its high efficiency and selectivity, H-Thr(Bzl)-OH·HCl enables chemists to manipulate and control the reactivity of amino acids, facilitating the production of complex peptides and proteins with precision and accuracy. Its application in chemical synthesis has proven to be essential for the advancement of bioorganic chemistry and pharmaceutical research.