
Catalog Number	AR00IBGK
Chemical Name	Benzene, 2-chloro-4-(methylsulfonyl)-1-nitro-
CAS Number	60854-81-1
Molecular Formula	C7H6ClNO4S
Molecular Weight	235.6448
MDL Number	MFCD28962794
SMILES	[O-][N+](=O)c1ccc(cc1Cl)S(=O)(=O)C

Benzene, 2-chloro-4-(methylsulfonyl)-1-nitro- is a versatile compound commonly used in chemical synthesis. Its unique structure allows for various reactions and transformations, making it a valuable building block in organic synthesis. This compound is often employed in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals due to its reactivity and ability to introduce functional groups into target molecules. Additionally, Benzene, 2-chloro-4-(methylsulfonyl)-1-nitro- can serve as a key intermediate in the production of complex organic compounds, playing a crucial role in the development of new materials and substances with specific properties. Its utility in chemical synthesis stems from its ability to participate in substitution, addition, and elimination reactions, enabling chemists to create novel compounds with tailored characteristics and applications.