
Catalog Number	AR00IBGF
Chemical Name	Fmoc-asp(ofm)-oh
CAS Number	608512-85-2
Molecular Formula	C33H27NO6
Molecular Weight	533.5706
MDL Number	MFCD01631977
SMILES	O=C(C[C@@H](C(=O)O)NC(=O)OCC1c2ccccc2c2c1cccc2)OCC1c2ccccc2c2c1cccc2

Fmoc-Asp(OFm)-OH is a key reagent utilized in chemical synthesis for the selective protection of the aspartic acid residue in peptide synthesis. This compound belongs to the class of Fmoc-protected amino acids, where Fmoc (Fluorenylmethyloxycarbonyl) serves as a temporary protecting group for the amino group during peptide synthesis.In the process of peptide synthesis, Fmoc-Asp(OFm)-OH is commonly employed to protect the carboxyl group of aspartic acid, thus allowing for the controlled addition of amino acids to the peptide chain. This selective protection strategy enables chemists to manipulate and control the sequence of amino acids within the peptide, ultimately leading to the formation of desired peptide structures with high purity and efficiency.The Fmoc-Asp(OFm)-OH reagent offers chemists a versatile tool for the synthesis of complex peptides and proteins, enabling precise control over the assembly of peptide sequences. Its compatibility with solid-phase peptide synthesis techniques further enhances its utility in the production of peptide libraries, bioconjugates, and other biologically active compounds.