
Catalog Number	AR00ELAW
Chemical Name	4-hydroxypraziquantel
CAS Number	60743-58-0
Molecular Formula	C19H24N2O3
Molecular Weight	328.4055
MDL Number	MFCD31630431
SMILES	OC1CCC(CC1)C(=O)N1CC(=O)N2C(C1)c1ccccc1CC2

2-(4-Hydroxycyclohexanecarbonyl)-2,3,6,7-tetrahydro-1H-pyrazino[2,1-a]isoquinolin-4(11bH)-one, commonly referred to as $name$, is a versatile compound used in chemical synthesis for its unique properties. In chemical synthesis, $name$ serves as a valuable building block due to its ability to participate in various reactions and form complex molecular structures. This compound can be utilized as a key intermediate in the synthesis of pharmaceuticals, agrochemicals, and materials with specialized properties. Its structure provides a fundamental framework for introducing specific functional groups and stereochemistry, making it a valuable tool for organic chemists working on the creation of novel compounds. Furthermore, the presence of the hydroxycyclohexanecarbonyl group in $name$ offers opportunities for selective derivatization and further manipulation, enabling the synthesis of structurally diverse molecules with tailored properties. By incorporating 2-(4-Hydroxycyclohexanecarbonyl)-2,3,6,7-tetrahydro-1H-pyrazino[2,1-a]isoquinolin-4(11bH)-one into synthetic routes, chemists can access a wide range of chemical space and potentially discover new materials or therapeutic agents.