
Catalog Number	AR003NMF
Chemical Name	5-Nitroisoquinoline
CAS Number	607-32-9
Molecular Formula	C9H6N2O2
Molecular Weight	174.1561
MDL Number	MFCD00006905
SMILES	[O-][N+](=O)c1cccc2c1ccnc2
NSC Number	3017

5-Nitroisoquinoline is a versatile compound widely used in chemical synthesis due to its unique properties and reactivity. In organic chemistry, it serves as a valuable building block for the synthesis of various biologically active compounds, pharmaceuticals, and functional materials. One of its key applications lies in the preparation of heterocyclic structures, where its nitro group can undergo various chemical transformations to yield diverse products. Specifically, 5-Nitroisoquinoline can be selectively reduced to the corresponding amino derivative, which can further participate in cross-coupling reactions to form complex molecules. Additionally, the nitro group can act as a directing group in metal-catalyzed C-H activation reactions, facilitating the regioselective functionalization of the isoquinoline ring system. Overall, the strategic incorporation of 5-Nitroisoquinoline in chemical synthesis enables the efficient and divergent construction of organic molecules with tailored properties and functionalities.