
Catalog Number	AR00EGKX
Chemical Name	2-NITRO-1-NAPHTHYLAMINE
CAS Number	607-23-8
Molecular Formula	C10H8N2O2
Molecular Weight	188.1827
MDL Number	MFCD00021543
SMILES	[O-][N+](=O)c1ccc2c(c1N)cccc2

The application of 2-Nitronaphthalen-1-amine in chemical synthesis involves its role as a versatile building block in the preparation of various functionalized compounds and complex organic molecules. This compound serves as a key intermediate in the synthesis of pharmaceuticals, agrochemicals, and advanced materials due to its ability to undergo various chemical reactions and transformations. By utilizing 2-Nitronaphthalen-1-amine as a starting material, chemists can access a wide range of structurally diverse substances with tailored properties and functionalities, making it a valuable tool in the field of synthetic chemistry.