
Catalog Number	AR00EJ5F
Chemical Name	3-(5-Formyl-thiophen-2-yl)benzoic acid
CAS Number	606970-74-5
Molecular Formula	C12H8O3S
Molecular Weight	232.25511999999995
MDL Number	MFCD06740280
SMILES	O=Cc1ccc(s1)c1cccc(c1)C(=O)O

3-(5-Formyl-thiophen-2-yl)-benzoic acid is a versatile compound used in chemical synthesis for its unique properties and reactivity. Its functional groups allow it to participate in various reactions, making it a valuable building block for the preparation of complex organic molecules.One key application of 3-(5-Formyl-thiophen-2-yl)-benzoic acid is in the synthesis of heterocyclic compounds. Due to the presence of the thiophene ring and the formyl group, this compound can serve as a precursor for the construction of diverse heterocycles with potential biological activities. These heterocyclic compounds play crucial roles in medicinal chemistry and drug discovery.Furthermore, 3-(5-Formyl-thiophen-2-yl)-benzoic acid can also be used in the development of materials with specific properties. By incorporating this compound into polymer structures or functional materials, its reactive groups can facilitate the formation of new materials with tailored characteristics, such as improved conductivity or optical properties.In addition, the presence of the formyl group in 3-(5-Formyl-thiophen-2-yl)-benzoic acid enables selective functionalization reactions, allowing chemists to introduce additional functionalities or modify the compound for specific purposes. This versatility makes it a valuable tool in the synthesis of novel compounds for a wide range of applications in organic chemistry.Overall, the application of 3-(5-Formyl-thiophen-2-yl)-benzoic acid in chemical synthesis offers a platform for the creation of diverse molecules with tailored properties for pharmaceuticals, materials science, and other interdisciplinary fields.