
Catalog Number	AR00ELZU
Chemical Name	2,4(1H,3H)-Quinazolinedione, 6-methoxy-7-(phenylmethoxy)-
CAS Number	60548-00-7
Molecular Formula	C16H14N2O4
Molecular Weight	298.2934
MDL Number	MFCD27963847
SMILES	COc1cc2c(cc1OCc1ccccc1)[nH]c(=O)[nH]c2=O

7-(Benzyloxy)-6-methoxyquinazoline-2,4(1H,3H)-dione is a versatile compound widely used in chemical synthesis. It serves as a valuable building block in the creation of pharmaceuticals, agrochemicals, and materials with diverse applications. This compound is particularly useful in the development of new drug molecules due to its unique structure and reactivity. In chemical synthesis, 7-(Benzyloxy)-6-methoxyquinazoline-2,4(1H,3H)-dione can undergo various functional group transformations and participate in key bond-forming reactions, making it a crucial intermediate in the synthesis of complex organic molecules. Its presence in the reaction pathway often leads to efficient and selective transformations, enabling chemists to access diverse chemical structures for further exploration and development.