
Catalog Number	AR00ELFI
Chemical Name	1-Chloro-5-nitronaphthalene
CAS Number	605-63-0
Molecular Formula	C10H6ClNO2
Molecular Weight	207.6131
MDL Number	MFCD01026465
SMILES	[O-][N+](=O)c1cccc2c1cccc2Cl

1-Chloro-5-nitronaphthalene, also known as CNN, is a versatile compound widely used in chemical synthesis processes. This compound serves as a key intermediate in the production of various organic compounds due to its unique chemical properties. In organic synthesis, 1-Chloro-5-nitronaphthalene serves as a crucial building block for the creation of a wide range of functionalized naphthalene derivatives. Its chloro and nitro functional groups allow it to participate in various chemical reactions such as nucleophilic substitution, reduction, and coupling reactions. Additionally, 1-Chloro-5-nitronaphthalene is commonly employed in the pharmaceutical industry for the synthesis of biologically active molecules and drug candidates. Its versatile nature and compatibility with different reaction conditions make it an essential reagent for the development of novel chemical entities with potential applications in medicine, materials science, and other fields.