
Catalog Number	AR00EB0R
Chemical Name	2-Propenoic acid, 3-(4-chlorophenyl)-, ethyl ester
CAS Number	6048-06-2
Molecular Formula	C11H11ClO2
Molecular Weight	210.6568
MDL Number	MFCD00045213
SMILES	CCOC(=O)/C=C/c1ccc(cc1)Cl

2-Propenoic acid, 3-(4-chlorophenyl)-, ethyl ester, is a versatile compound widely used in chemical synthesis. It serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and advanced materials. This compound is valued for its ability to undergo a range of chemical reactions, allowing for the efficient synthesis of complex molecular structures. In pharmaceutical development, it is utilized for producing new drug candidates with diverse biological activities. In agrochemical applications, it contributes to the synthesis of crop protection agents and plant growth regulators. Additionally, in material science, it is employed in the production of polymers and specialty chemicals, enabling the design of innovative products with tailored properties.