
Catalog Number	AR00EMSR
Chemical Name	(3a,5b,7a,12a)-3,12-dihydroxy-7-(sulfooxy)-Cholan-24-oic acid
CAS Number	60320-05-0
Molecular Formula	C24H40O8S
Molecular Weight	488.6346
SMILES	O[C@@H]1CC[C@]2([C@@H](C1)C[C@H]([C@@H]1[C@@H]2C[C@H](O)[C@]2([C@H]1CC[C@@H]2[C@@H](CCC(=O)O)C)C)OS(=O)(=O)O)C

The compound (3α,5β,7α,12α)-3,12-Dihydroxy-7-(sulfooxy)cholan-24-oic acid plays a crucial role in chemical synthesis as a versatile building block. Its unique structure and functional groups make it an indispensable intermediate for the preparation of various pharmaceuticals, steroids, and bile acids. In particular, this compound is commonly used for the modification and derivatization of cholic acid derivatives, allowing for the development of novel bioactive molecules with enhanced properties. Additionally, its sulfooxy group can serve as a reactive handle for conjugation reactions, enabling the attachment of different molecular entities for the generation of targeted drug delivery systems or prodrugs. Overall, the application of (3α,5β,7α,12α)-3,12-Dihydroxy-7-(sulfooxy)cholan-24-oic acid in chemical synthesis showcases its significance in the synthesis of biologically active compounds with potential therapeutic applications.