
Catalog Number	AR00EELS
Chemical Name	T Epitope, Threonyl
CAS Number	60280-58-2
Molecular Formula	C18H32N2O13
Molecular Weight	484.4523
MDL Number	MFCD02683396
SMILES	OCC1O[C@H](O[C@@H]([C@@H](C(=O)O)N)C)[C@H]([C@H]([C@H]1O)O[C@@H]1OC(CO)[C@@H]([C@@H]([C@@H]1O)O)O)NC(=O)C

The compound O-[2-(Acetylamino)-2-deoxy-3-O-β-D-galactopyranosyl-α-D-galactopyranosyl]-L-threonine is commonly used in chemical synthesis as a key building block for the creation of complex carbohydrates. Its unique structure and functional groups make it an essential component in the development of glycosylation reactions, which are fundamental in the construction of oligosaccharides with specific stereochemistry and regiochemistry. This compound serves as a versatile intermediate in the synthesis of biologically important molecules, particularly in the field of glycochemistry where precise control over carbohydrate structures is crucial for various applications. Its strategic placement within carbohydrate chains allows for the controlled assembly of complex structures, making it a valuable tool in the synthesis of glycans and glycoconjugates for a wide range of research and industrial purposes.