
Catalog Number	AR00IBDD
Chemical Name	DL-THREONINE, HYDRATE (2:1)
CAS Number	6028-28-0
Molecular Formula	C8H20N2O7
Molecular Weight	256.2536
MDL Number	MFCD00063722
SMILES	C[C@H]([C@@H](C(=O)O)N)O.C[C@H]([C@@H](C(=O)O)N)O.O

DL-Threonine hemihydrate, a compound essential in organic synthesis, plays a crucial role in chemical processes due to its unique properties. When utilized in chemical synthesis, DL-Threonine hemihydrate serves as a key component in the production of amino acids, pharmaceuticals, and other organic compounds. Its structure enables it to participate in various reactions, facilitating the creation of complex molecules. Additionally, DL-Threonine hemihydrate acts as a chiral source, allowing for the synthesis of enantiomerically pure substances. In research and industrial applications, this compound is instrumental in the development of new materials and drug compounds, making it a valuable tool for chemists and researchers alike.