
Catalog Number	AR00JCAK
Chemical Name	(1S)-1-(1-adamantyl)butan-1-amine
CAS Number	60196-91-0
Molecular Formula	C14H25N
Molecular Weight	207.355
SMILES	CCCC(C12CC3CC(C2)CC(C1)C3)N

In chemical synthesis, α-Propyltricyclo[3.3.1.13,7]decane-1-methanamine serves as a versatile building block for creating complex organic molecules. Its unique structure provides a scaffold that can be functionalized in various ways to facilitate the formation of intricate molecular structures. Its three-dimensional shape and the presence of an amine functional group enable it to participate in a variety of synthetic transformations, including couplings, additions, and substitutions. By incorporating α-Propyltricyclo[3.3.1.13,7]decane-1-methanamine into a synthetic route, chemists can access novel compounds with potential applications in pharmaceuticals, materials science, and other fields requiring the production of diverse and structurally complex molecules.