
Catalog Number	AR00EMKB
Chemical Name	Diethyl 2-isopropyl-3-oxosuccinate
CAS Number	59916-75-5
Molecular Formula	C11H18O5
Molecular Weight	230.2576
MDL Number	MFCD00511085
SMILES	CCOC(=O)C(=O)C(C(=O)OCC)C(C)C

Diethyl 2-isopropyl-3-oxosuccinate, also known as $name$, is a versatile compound widely utilized in chemical synthesis. This compound serves as a key intermediate in the production of various organic compounds due to its unique structural properties. In chemical synthesis, $name$ is commonly employed as a starting material for the preparation of esters, ketones, and other complex molecules. Its functional groups make it a valuable building block for the synthesis of pharmaceuticals, agrochemicals, and fine chemicals. With its ability to undergo various chemical reactions, $name$ offers chemists a versatile tool for designing and creating novel compounds with desired properties and functionalities.