
Catalog Number	AR00EC9M
Chemical Name	13,14-DIHYDRO-15-KETO PROSTAGLANDIN D2
CAS Number	59894-07-4
Molecular Formula	C20H32O5
Molecular Weight	352.4651
MDL Number	MFCD00885499
SMILES	CCCCCC(=O)CC[C@H]1C(=O)CC(C1C/C=CCCCC(=O)O)O

13,14-Dihydro-15-keto-PGD2, also known as prostaglandin D2, is a key intermediate in organic synthesis. This chemical compound plays a crucial role in various chemical reactions and processes, particularly in the synthesis of pharmaceuticals and bioactive compounds. Due to its unique structural properties and reactivity, 13,14-Dihydro-15-keto-PGD2 serves as a versatile building block for the creation of complex molecules with specific functionalities. In chemical synthesis, this compound is utilized as a starting material for the development of new drugs, agrochemicals, and materials with diverse applications in industries such as pharmaceuticals, biotechnology, and materials science. Its selective functional groups and ability to undergo various transformations make it a valuable tool for chemists and researchers seeking to design novel compounds with tailored properties and activities.