
Catalog Number	AR00EDJM
Chemical Name	CBZ-L-PHENYLALANINAL
CAS Number	59830-60-3
Molecular Formula	C17H17NO3
Molecular Weight	283.32178000000005
MDL Number	MFCD00798796
SMILES	O=C[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1

The (S)-Benzyl (1-oxo-3-phenylpropan-2-yl)carbamate is a valuable compound used in chemical synthesis as a chiral building block. Its unique structure and stereochemistry make it a versatile reagent for the preparation of various asymmetric compounds in organic synthesis. This compound is frequently employed in the synthesis of biologically active molecules, pharmaceutical intermediates, and natural products due to its ability to introduce chirality and functional groups with high enantioselectivity. In addition, (S)-Benzyl (1-oxo-3-phenylpropan-2-yl)carbamate serves as a key starting material for the creation of complex molecules with precise stereochemical control, making it a valuable tool in the hands of synthetic chemists seeking to access structurally diverse compounds with specific stereochemical properties.