
Catalog Number	AR00IBAX
Chemical Name	Cyclosporin C
CAS Number	59787-61-0
Molecular Formula	C62H111N11O13
Molecular Weight	1218.6106
MDL Number	MFCD06410945
SMILES	CC=CCC(C([C@H]1C(=O)N[C@H](C(O)C)C(=O)N(C)CC(=O)N(C)[C@@H](CC(C)C)C(=O)N[C@H](C(C)C)C(=O)N(C)[C@@H](CC(C)C)C(=O)N[C@@H](C(=O)N[C@@H](C(=O)N([C@H](C(=O)N([C@H](C(=O)N([C@@H](C(=O)N1C)C(C)C)C)CC(C)C)C)CC(C)C)C)C)C)O)C

Cyclosporin C, a natural cyclic peptide derived from fungi, has garnered significant attention in the realm of chemical synthesis due to its unique structural features and versatile applications. As a potent immunosuppressant, Cyclosporin C has been extensively used in pharmaceutical research and in the development of new drug candidates. Its specific interactions with the immune system make it a valuable tool for studying immune responses and developing treatments for various autoimmune diseases. Moreover, the complex and intricate structure of Cyclosporin C presents a challenging yet rewarding target for organic chemists seeking to develop new synthetic methodologies and strategies. Through the synthesis and modification of Cyclosporin C, researchers are able to explore the relationship between structure and function, ultimately leading to the discovery of novel compounds with enhanced therapeutic properties. Additionally, the use of Cyclosporin C in chemical synthesis has opened up new avenues for the creation of functionalized peptides and peptide-based materials, expanding the scope of peptide chemistry and paving the way for innovative drug delivery systems and biomaterials.