
Catalog Number	AR00EDSA
Chemical Name	3-(4-METHYLPHENYL)-1H-PYRAZOLE-5-CARBOXYLIC ACID ETHYL ESTER
CAS Number	595610-41-6
Molecular Formula	C13H14N2O2
Molecular Weight	230.2625
MDL Number	MFCD07364375
SMILES	CCOC(=O)c1[nH]nc(c1)c1ccc(cc1)C

Ethyl 5-(4-methylphenyl)-1H-pyrazole-3-carboxylate is a versatile compound commonly used in chemical synthesis due to its unique structure and reactivity. This compound can serve as a key building block in the preparation of various pharmaceuticals, agrochemicals, and advanced materials. Its pyrazole ring provides opportunities for further modification and derivatization, allowing for the creation of new and diverse molecular structures.In organic synthesis, Ethyl 5-(4-methylphenyl)-1H-pyrazole-3-carboxylate can participate in a variety of reactions such as nucleophilic substitution, acylation, and condensation reactions. Its presence can introduce specific functionalities or structural motifs into target molecules, influencing their biological or chemical properties.Overall, the strategic incorporation of Ethyl 5-(4-methylphenyl)-1H-pyrazole-3-carboxylate in chemical synthesis enables the efficient and controlled preparation of complex molecules with tailored properties for various applications.