
Catalog Number	AR00EDE2
Chemical Name	SOYASAPOGENOL B(P)
CAS Number	595-15-3
Molecular Formula	C30H50O3
Molecular Weight	458.7162
MDL Number	MFCD00075988
SMILES	OC[C@@]1(C)[C@@H](O)CC[C@]2([C@H]1CC[C@@]1([C@@H]2CC=C2[C@@]1(C)CC[C@@]1([C@H]2CC(C[C@H]1O)(C)C)C)C)C

Soyasapogenol B, a triterpenoid compound derived from soybeans, plays a crucial role in chemical synthesis as a versatile starting material. Its unique chemical structure and reactivity make it a valuable intermediate in the production of various bioactive compounds and pharmaceuticals. In organic synthesis, Soyasapogenol B serves as a key building block for the creation of novel molecules with potential therapeutic applications. Its diverse functional groups allow for the modification of its structure through various chemical reactions, enabling the synthesis of customized derivatives for specific research or industrial purposes. Furthermore, the presence of multiple chiral centers in Soyasapogenol B offers opportunities for the development of enantioselective synthesis strategies, adding complexity and precision to chemical transformations. Overall, the utility of Soyasapogenol B in chemical synthesis highlights its importance in advancing the field of organic chemistry and drug discovery.