
Catalog Number	AR00EBGH
Chemical Name	4-Cyanobiphenyl-4'-pentylbenzoate
CAS Number	59443-80-0
Molecular Formula	C25H23NO2
Molecular Weight	369.4556
MDL Number	MFCD00482612
SMILES	CCCCCc1ccc(cc1)C(=O)Oc1ccc(cc1)c1ccc(cc1)C#N

4'-Cyano-[1,1'-biphenyl]-4-yl 4-pentylbenzoate is a versatile compound used in chemical synthesis for various applications. This compound serves as a key building block in the creation of novel materials and pharmaceuticals. Its unique molecular structure enables it to participate in a range of chemical reactions, making it valuable in the development of advanced organic compounds.In chemical synthesis, 4'-Cyano-[1,1'-biphenyl]-4-yl 4-pentylbenzoate acts as a precursor for the synthesis of functional materials with tailored properties. By incorporating this compound into the synthesis process, researchers can introduce specific functionalities and structural motifs into the final product. This allows for the fine-tuning of material properties such as solubility, stability, and reactivity.Furthermore, the presence of the cyano group in 4'-Cyano-[1,1'-biphenyl]-4-yl 4-pentylbenzoate offers the potential for further derivatization, enabling the introduction of additional functional groups or modifications to the molecular structure. This flexibility makes it a valuable tool in the hands of synthetic chemists seeking to design and create new molecules with targeted properties.Overall, the application of 4'-Cyano-[1,1'-biphenyl]-4-yl 4-pentylbenzoate in chemical synthesis opens up a wide range of possibilities for the development of advanced materials and pharmaceutical compounds. Its versatility and reactivity make it a valuable asset in the toolbox of researchers and chemists working in the field of organic chemistry and material science.