
Catalog Number	AR00EM8Y
Chemical Name	cyclopropyl[3-(trifluoromethyl)phenyl]methanamine
CAS Number	59382-27-3
Molecular Formula	C11H12F3N
Molecular Weight	215.2149
MDL Number	MFCD05192009
SMILES	NC(c1cccc(c1)C(F)(F)F)C1CC1

Cyclopropyl[3-(trifluoromethyl)phenyl]methanamine, commonly known as $name$, is a versatile chemical compound widely used in organic synthesis. This compound plays a crucial role as a building block in the construction of complex molecules and pharmaceuticals. Its unique structure, combining a cyclopropyl ring with a trifluoromethylphenyl moiety, imparts specific properties that make it valuable for various chemical transformations. In organic synthesis, $name$ is utilized for the introduction of the cyclopropyl group into target molecules, offering a strategic approach to modulate their physicochemical and biological characteristics. Furthermore, the trifluoromethyl group enhances the lipophilicity and metabolic stability of the resulting compounds, making them attractive candidates for drug discovery and development studies. The application of cyclopropyl[3-(trifluoromethyl)phenyl]methanamine in chemical synthesis highlights its significance in enabling the creation of novel compounds with potential biological activities and therapeutic benefits.